Home
Products
Sibiricaxanthone B
| Product Name | Sibiricaxanthone B |
| Price: | $263 / 10mg |
| Catalog No.: | CN05781 |
| CAS No.: | 241125-81-5 |
| Molecular Formula: | C24H26O14 |
| Molecular Weight: | 538.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)OC1OCC(C1O)(O)CO)c1c(O)cc2c(c1O)c(=O)c1c(o2)ccc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sibiricaxanthone B is a xanthone isolated from Polygala tenuifolia[1]. |
| In Vivo | Sibiricaxanthone B, tenuifolin, sibiricose A5, sibiricose A6, tenuifoliside A, ginsenoside Re and ginsenoside Rb1 are oral administered after Kai-Xin-San, The results indicated that Sibiricaxanthone B shows no significant differences in pharmacokinetic parameters in normal and AD rats[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 964.4±65.0 °C at 760 mmHg |
| Flash Point | 328.7±27.8 °C |
| Exact Mass | 538.132263 |
| LogP | 0.14 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |