Home
Products
Sibiricose A6
| Product Name | Sibiricose A6 |
| Price: | $219 / 10mg |
| Catalog No.: | CN06872 |
| CAS No.: | 241125-75-7 |
| Molecular Formula: | C23H32O15 |
| Molecular Weight: | 548.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@]([C@H]([C@@H]1O)OC(=O)/C=C/c1cc(OC)c(c(c1)OC)O)(CO)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sibiricose A6 is an oligosaccharide ester isolated from Polygalae Radix with potent antioxidant activity[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 837.3±65.0 °C at 760 mmHg |
| Flash Point | 281.3±27.8 °C |
| Exact Mass | 548.174133 |
| LogP | -2.05 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8℃ |