Home
Products
Isocurcumenol
| Product Name | Isocurcumenol |
| Price: | $190 / 10mg |
| Catalog No.: | CN09314 |
| CAS No.: | 24063-71-6 |
| Molecular Formula: | C15H22O2 |
| Molecular Weight: | 234.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma wenyujin Y.H.Chen et C.Ling. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C1C[C@]23O[C@]1(O)CC(=C)[C@@H]3CC[C@@H]2C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isocurcumenol, an estrogen receptor alpha (ERα) inhibitor isolated from Curcuma zedoaria Rhizomes, possesses anti-tumor acticity, with IC50 values of 99.1µg/mL and 178.2 µg/mL in DLA and KB cells, respectively[1][2]. |
| In Vitro | Isocurcumenol (12.5-400 µg/mL, 24-48 h) dose-dependently inhibits cancer cells proliferation[1]. isocurcumenol does not exhibit any significant toxicity on normal chicken embryo fibroblast cells and lymphocytes[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 351.0±42.0 °C at 760 mmHg |
| Flash Point | 147.9±22.1 °C |
| Exact Mass | 234.161987 |
| PSA | 29.46000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |