Home
Products
Meranzin
| Product Name | Meranzin |
| Price: | $146 / 5mg |
| Catalog No.: | CN06288 |
| CAS No.: | 23971-42-8 |
| Molecular Formula: | C15H16O4 |
| Molecular Weight: | 260.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Cryst. |
| Source: | The peels of Citrus maxima |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1CC1OC1(C)C)oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Meranzin is an absorbed bioactive compound from the Traditional Chinese Medicine (TCM) Chaihu-Shugan-San (CSS). Meranzin, isolated from leaves of Murraya exotica L., regulates the shared alpha 2-adrenoceptor and involves the AMPA-ERK1/2–BDNF signaling pathway. Meranzin has the potential for the prevention of the comorbidity of atherosclerosis and depression[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 414.8±45.0 °C at 760 mmHg |
| Flash Point | 185.3±28.8 °C |
| Exact Mass | 260.104858 |
| PSA | 51.97000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |