Home
Products
Lappaconine
| Product Name | Lappaconine |
| Price: | Inquiry |
| Catalog No.: | CN00097 |
| CAS No.: | 23943-93-3 |
| Molecular Formula: | C23H37NO6 |
| Molecular Weight: | 423.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum carmichaeli Debx |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CO[C@H]1C[C@]2(O)[C@H]3C[C@H]4[C@]5([C@@H]6C[C@H]1[C@@H]([C@]26O)OC)[C@@H]3N(CC)C[C@]4(O)CC[C@@H]5OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.33g/cm3 |
| Boiling Point | 572.4ºC at 760 mmHg |
| Flash Point | 300ºC |
| Exact Mass | 423.26200 |
| PSA | 91.62000 |
| LogP | 0.19230 |
| Vapour Pressure | 1.74E-15mmHg at 25°C |