Home
Products
Liensinine perchlorate
| Product Name | Liensinine perchlorate |
| Price: | $103 / 20mg |
| Catalog No.: | CN02179 |
| CAS No.: | 2385-63-9 |
| Molecular Formula: | C37H42N2O6.ClHO4 |
| Molecular Weight: | 711.20 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The plantule of Nelumbo nucifera Gaertn. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[Cl](=O)(=O)=O.COc1cc2CCN(C(c2cc1Oc1cc(ccc1O)CC1N(C)CCc2c1cc(OC)c(c2)OC)Cc1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Liensinine Perchlorate is a constituent of Nelumbo nucifera Gaertn, with ani-hypertension and anti-cancer activities. Liensinine Perchlorate induces colorectal cancer (CRC) cell apoptosis[1]. |
| Target | IC50: apoptosis[1] |
| In Vitro | Liensinine Perchlorate is found to induce apoptosis and exert a significant inhibitory effect on the proliferation and colony-forming ability of CRC cells in a dose-dependent manner without any observed cytotoxicity on normal colorectal epithelial cells[1]. |
| Exact Mass | 710.260620 |
| PSA | 155.30000 |
| LogP | 6.49140 |