Home
Products
4,4'-Dimethoxychalcone
| Product Name | 4,4'-Dimethoxychalcone |
| Price: | Inquiry |
| Catalog No.: | CN05604 |
| CAS No.: | 2373-89-9 |
| Molecular Formula: | C17H16O3 |
| Molecular Weight: | 268.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Caesalpinia sappan Linn |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)/C=C/C(=O)c1ccc(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4,4'-Dimethoxychalcone, isolated from the plant Angelica keiskei koidzumi, acts as a natural autophagy inducer with anti-ageing properties[1]. |
| Target | Autophagy[1] |
| In Vivo | The flavonoid 4,4'-Dimethoxychalcone acts as an anti-ageing compound with cardioprotective effects in mice and the potential to promote longevity across species[1]. 4,4'-Dimethoxychalcone (100 mg/kg; intraperitoneally) efficiently triggered autophagic flux in the heart and liver from wild type (WT) C57BL/6 mice[1]. Animal Model: 6-week-old male wild type C57BL/6 or Atg4b-/- mice[1] Dosage: 100 mg/kg Administration: Injected intraperitoneally with a single Result: Triggered autophagic flux in the heart and liver. |
| Density | 1.128g/cm3 |
| Boiling Point | 444.6ºC at 760 mmHg |
| Flash Point | 214.6ºC |
| Exact Mass | 268.11000 |
| PSA | 35.53000 |
| LogP | 3.59990 |
| Vapour Pressure | 4.23E-08mmHg at 25°C |