Home
Products
Damascenone
| Product Name | Damascenone |
| Price: | $77 / 20mg |
| Catalog No.: | CN06327 |
| CAS No.: | 23696-85-7 |
| Molecular Formula: | C13H18O |
| Molecular Weight: | 190.3 g/mol |
| Purity: | >=95% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Epipremnum pinnatum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC=CC(=O)C1=C(C)C=CCC1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Damascenone ((E/Z)-Damascenone) is an active compound of Epipremnum pinnatum with anti-inflammatory activity[1]. Damascenone is a mixture complex of E-isomer-Damascenone and Z-isomer Damascenone. |
| In Vitro | β-Damascenone also inhibits the upregulation of inflammatory proteins as demonstrated by immune assays for cell surface E-selectin and secreted TNF-α[1]. β-Damascenone inhibits NF-κB signaling pathway in vitro in human cellular systems that has been activated with different inflammatory stimuli[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 275.6±10.0 °C at 760 mmHg |
| Flash Point | 111.0±14.0 °C |
| Exact Mass | 190.135757 |
| PSA | 17.07000 |
| LogP | 4.04 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |