Home
Products
Olaquindox
| Product Name | Olaquindox |
| Price: | $46 / 20mg |
| Catalog No.: | CN01313 |
| CAS No.: | 23696-28-8 |
| Molecular Formula: | C12H13N3O4 |
| Molecular Weight: | 263.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Cyprinus carpio var. Jian |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCCNC(=O)c1c(C)[n+]([O-])c2c([n+]1[O-])cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Olaquindox, a quinoxalin derivative, is an orally active antibiotic veterinary drug. Olaquindox stimulates growth and decreases intestinal mucosal immunity of piglets[1]. |
| In Vivo | Olaquindox (100 mg/kg in the basal diet) improves average daily gain and feed conversion ratio (FCR)[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 343.3ºC |
| Flash Point | >204.4ºC |
| Exact Mass | 263.090607 |
| PSA | 100.25000 |
| LogP | -2.20 |
| Storage condition | 0-6°C |