Home
Products
Vicenin -2
| Product Name | Vicenin -2 |
| Price: | $146 / 10mg |
| Catalog No.: | CN05140 |
| CAS No.: | 23666-13-9 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Chrysanthemi indici L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)c([C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)c(c2c1oc(cc2=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vicenin 2 is an angiotensin-converting enzyme (ACE) inhibitor (IC50=43.83 μM) from the aerial parts of Desmodium styracifolium[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 974.7±65.0 °C at 760 mmHg |
| Flash Point | 323.7±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 271.20000 |
| LogP | -0.10 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |