Home
Products
Kaempferol-3-O-galactoside
| Product Name | Kaempferol-3-O-galactoside |
| Price: | $293 / 5mg |
| Catalog No.: | CN05113 |
| CAS No.: | 23627-87-4 |
| Molecular Formula: | C21H20O11 |
| Molecular Weight: | 448.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Senecio argunensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(cc2)O)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol 3-O-β-D-galactopyranoside (Trifolin) is a derivative of flavonoid, which is isolated from the aerial part of Consolida oliveriana[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 823.2±65.0 °C at 760 mmHg |
| Flash Point | 291.6±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 190.28000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |