Home
Products
Procyanidin B3
| Product Name | Procyanidin B3 |
| Price: | $190 / 5mg |
| Catalog No.: | CN05525 |
| CAS No.: | 23567-23-9 |
| Molecular Formula: | C30H26O12 |
| Molecular Weight: | 578.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vitis vinifera L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)O[C@@H]([C@H]([C@@H]2c1c(O)cc(c2c1O[C@@H]([C@H](C2)O)c1ccc(c(c1)O)O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Procyanidin B3 is a natural product, acts as a specific HAT inhibitor, binds to the other site of p300 instead of the active site, selectively inhibits p300-mediated androgen receptor acetylation. Procyanidin B3 has no effect on HDAC or HMT (histone methyltransferase)[1]. |
| Target | p300[1] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 955.3±65.0 °C at 760 mmHg |
| Flash Point | 531.6±34.3 °C |
| Exact Mass | 578.142456 |
| PSA | 220.76000 |
| LogP | 0.30 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | ?20°C |