Home
Products
Peimine
| Product Name | Peimine |
| Price: | $43 / 20mg |
| Catalog No.: | CN02106 |
| CAS No.: | 23496-41-5 |
| Molecular Formula: | C27H45NO3 |
| Molecular Weight: | 431.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbus of Fritillaria thunbergii Miq. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@H](C1)[C@@H](O)C[C@@H]1[C@@H]2C[C@@H]2[C@H]1CC[C@H]1[C@H]2CN2C[C@@H](C)CC[C@H]2[C@@]1(C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Peimine(Dihydroisoimperialine; Verticine) is a natural compound with good anti-inflammatory effects in vivo.IC50 value:Target:Peimine (0-25 mg/L) significantly inhibited tumor necrosis factor (TNF)-α, interleukin (IL)-6, IL-1β, and increased IL-10 production. Furthermore, peimine significantly inhibited the phosphorylation of p38, ERK and c-jun N-terminal kinase (JNK) as well as decreased p65 and IκB. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 568.4±50.0 °C at 760 mmHg |
| Flash Point | 275.3±28.8 °C |
| Exact Mass | 431.339935 |
| PSA | 63.93000 |
| LogP | 4.45 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Storage condition | 2-8℃ |