Home
Products
2-Methoxy-1,4-naphthoquinone
| Product Name | 2-Methoxy-1,4-naphthoquinone |
| Price: | Inquiry |
| Catalog No.: | CN05857 |
| CAS No.: | 2348-82-5 |
| Molecular Formula: | C11H8O3 |
| Molecular Weight: | 188.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The barks of Juglans regia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1=CC(=O)c2c(C1=O)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lawsone methyl ether (2-Methoxy-1,4-naphthoquinone), isolated from Impatiens balsamina L. and Swertia calycina, exhibits potent antifungal and antibacterial activities[1]. |
| In Vitro | The value of both minimal inhibitory concentration and minimal fungicidal concentration of Lawsone methyl ether (2-Methoxy-1,4-naphthoquinone) against Candida was 1.25 lg⁄ml[1]. |
| Density | 1.28g/cm3 |
| Boiling Point | 339.8ºC at 760mmHg |
| Flash Point | 152.7ºC |
| Exact Mass | 188.04700 |
| PSA | 43.37000 |
| LogP | 1.59590 |
| Vapour Pressure | 8.98E-05mmHg at 25°C |
| Storage condition | -20℃ |