Home
Products
Decursinol
| Product Name | Decursinol |
| Price: | Inquiry |
| Catalog No.: | CN06190 |
| CAS No.: | 23458-02-8 |
| Molecular Formula: | C14H14O4 |
| Molecular Weight: | 246.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica gigas. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)cc1c(c2)C[C@@H](C(O1)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Decursinol, isolated from the roots of Angelica gigas, possesses antinociceptive effect with orally bioavailability. Decursinol possesses anti-tumor and anti-metastasis activity[1]. |
| Density | 1.293g/cm3 |
| Boiling Point | 433.6ºC at 760mmHg |
| Flash Point | 167.9ºC |
| Exact Mass | 246.08900 |
| PSA | 59.67000 |
| LogP | 1.86740 |
| Vapour Pressure | 2.74E-08mmHg at 25°C |
| Storage condition | 2-8°C |