Home
Products
Alternariol monomethyl ether
| Product Name | Alternariol monomethyl ether |
| Price: | Inquiry |
| Catalog No.: | CN03583 |
| CAS No.: | 23452-05-3 |
| Molecular Formula: | C15H12O5 |
| Molecular Weight: | 272.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The media of Alternaria alternata strain 261. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)c1c(C)cc(cc1oc2=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Djalonensone, isolated from the roots of Anthocleista djalonensis (Loganiaceae), is an important taxonomic marker of the plant species[1]. |
| Density | 1.427g/cm3 |
| Boiling Point | 559.2ºC at 760mmHg |
| Flash Point | 217.4ºC |
| Exact Mass | 272.06800 |
| PSA | 79.90000 |
| LogP | 2.67440 |
| Vapour Pressure | 0mmHg at 25°C |