Home
Products
Physcion 8-O-beta-D-monoglucoside
| Product Name | Physcion 8-O-beta-D-monoglucoside |
| Price: | $219 / 10mg |
| Catalog No.: | CN05944 |
| CAS No.: | 23451-01-6 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The roots and rhizomes of Rheum palmatum L |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(OC)cc3c2C(=O)c2c(C3=O)cc(cc2O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Physcion 8-O-β-D-glucopyranosideis an anthraquinone compound isolated from Rumex japonicus Houtt. Physcion 8-O-β-D-glucopyranoside exerts anti-inflammatory and anti-cancer properties, can be for common malignancy cancer research[1]. |
| Boiling Point | 796.3±60.0 °C(Predicted) |