Home
Products
Swertianolin
| Product Name | Swertianolin |
| Price: | $146 / 10mg |
| Catalog No.: | CN05782 |
| CAS No.: | 23445-00-3 |
| Molecular Formula: | C20H20O11 |
| Molecular Weight: | 436.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The herbs of Swertia bimaculata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(OC)cc3c2c(=O)c2c(o3)c(O)ccc2O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Swertianolin, a xanthone isolated from Gentianella Acuta, inhibits acetylcholinesterase (AChE). Swertianolin also exhibits anti-HBV and anti-bacterial activity[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 806.3±65.0 °C at 760 mmHg |
| Flash Point | 287.7±27.8 °C |
| Exact Mass | 436.100555 |
| PSA | 179.28000 |
| LogP | -1.13 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2-8℃ |