Home
Products
Tetrahydropiperin
| Product Name | Tetrahydropiperin |
| Price: | $23 / 20mg |
| Catalog No.: | CN00971 |
| CAS No.: | 23434-88-0 |
| Molecular Formula: | C17H23NO3 |
| Molecular Weight: | 289.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Piper nigrum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(N1CCCCC1)CCCCc1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tetrahydropiperine, a cyclohexyl analogue of piperine, is the first natural aryl pentanamide from Piper longum[1]. Tetrahydropiperine (compound 14) inhibits the cytochrome P450 (CYP) isoform CYP1A1/arylhydrocarbon hydroxylase (AHH; IC50=23 µM)[2]. |
| Target | CYP1A1:23 μM (IC50) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 469.9±24.0 °C at 760 mmHg |
| Flash Point | 238.0±22.9 °C |
| Exact Mass | 289.167786 |
| PSA | 38.77000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20℃ |