Home
Products
Emodin-8-beta-D-glucoside
| Product Name | Emodin-8-beta-D-glucoside |
| Price: | $117 / 20mg |
| Catalog No.: | CN06003 |
| CAS No.: | 23313-21-5 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots and rhizomes of Rheum palmatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2C(=O)c2c(C3=O)cc(cc2O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Emodin-8-glucoside is an anthraquinone derivative isolated from Aloe vera, binds to minor groove of DNA[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 798.7±60.0 °C at 760 mmHg |
| Flash Point | 284.2±26.4 °C |
| Exact Mass | 432.105652 |
| PSA | 173.98000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2-8C |