Home
Products
5,7-Diacetoxy-8-methoxyflavone
| Product Name | 5,7-Diacetoxy-8-methoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN05440 |
| CAS No.: | 23246-80-2 |
| Molecular Formula: | C20H16O7 |
| Molecular Weight: | 368.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Scutellaria baicalensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC(=O)C)cc(c2c1oc(cc2=O)c1ccccc1)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7-Diacetoxy-8-methoxyflavone is a natural product that could come from scutellaria genus plants. 5,7-Diacetoxy-8-methoxyflavone has inhibitory activity for cAMP phosphodiesterase[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 540.9±50.0 °C at 760 mmHg |
| Flash Point | 238.3±30.2 °C |
| Exact Mass | 368.089600 |
| PSA | 92.04000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |