Home
Products
Columbianetin acetate
| Product Name | Columbianetin acetate |
| Price: | $117 / 10mg |
| Catalog No.: | CN06180 |
| CAS No.: | 23180-65-6 |
| Molecular Formula: | C16H16O5 |
| Molecular Weight: | 288.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica biserrata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC([C@H]1Oc2c(C1)c1oc(=O)ccc1cc2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Columbianetin Acetate is a phytoalexin associated with celery (Apium graveolens) resistance to pathogens during storage. Columbianetin exhibits excellent anti-fungal and anti-inflammatory activity[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 437.7±45.0 °C at 760 mmHg |
| Flash Point | 195.0±28.8 °C |
| Exact Mass | 288.099762 |
| PSA | 65.74000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8℃ |