Home
Products
Vincosamide
| Product Name | Vincosamide |
| Price: | $409 / 10mg |
| Catalog No.: | CN02097 |
| CAS No.: | 23141-27-7 |
| Molecular Formula: | C26H30N2O8 |
| Molecular Weight: | 498.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Vincoside lactam |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C3[C@H]([C@H]2C=C)C[C@H]2N(C3=O)CCc3c2[nH]c2c3cccc2)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vincosamide, an alkaloid from Psychotria leiocarpa extract, inhibits the acetylcholinesterase (AChE) activity with anti-inflammatory activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 816.2±65.0 °C at 760 mmHg |
| Flash Point | 447.4±34.3 °C |
| Exact Mass | 498.200226 |
| PSA | 144.71000 |
| LogP | -0.55 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | ?20°C |