Home
Products
Tectorigenin 7-O-xylosylglucoside
| Product Name | Tectorigenin 7-O-xylosylglucoside |
| Price: | $277 / 5mg |
| Catalog No.: | CN04845 |
| CAS No.: | 231288-19-0 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1c(OC2OC(COC3OCC(C(C3O)O)O)C(C(C2O)O)O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tectorigenin 7-O-Xylosyl Glucoside is a glycosidic isoflavone isolated from Pueraria thomsonii flower[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 929.9±65.0 °C at 760 mmHg |
| Flash Point | 308.9±27.8 °C |
| Exact Mass | 594.158447 |
| LogP | 1.44 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |