Home
Products
Methyl 4-hydroxy-3-methoxycinnamate
| Product Name | Methyl 4-hydroxy-3-methoxycinnamate |
| Price: | Inquiry |
| Catalog No.: | CN03367 |
| CAS No.: | 2309-07-1 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Haloxylon griffithii. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)C=Cc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ferulic acid methyl ester (Methyl ferulate) is a derivative of ferulic acid, isolated from Stemona tuberosa, with anti-inflammatory and antioxidant properties[1][2]. Ferulic acid methyl ester is a cell membrane and brain permeable compound, shows free radical scavenging ability, used in the research of neurodegenerative disorders[1]. Ferulic acid methyl ester inhibits COX-2 expression, blocks p-p38 and p-JNK in primary bone marrow derived-macrophages[2]. |
| Target | p38 |
| In Vitro | Ferulic acid methyl ester (Methyl ferulate; 5, 10, 25 µg/mL) suppresses TNFα, IL6, IFNγ but not IL10, inhibits NO generation at 10 and 25 µg/mL, in primary bone marrow derived-macrophages (BMDMs)[2]. Ferulic acid methyl ester (25 µg/mL) inhibits COX-2 expression, blocks p-p38 and p-JNK[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 338.1±27.0 °C at 760 mmHg |
| Flash Point | 130.4±17.2 °C |
| Exact Mass | 208.073563 |
| PSA | 55.76000 |
| LogP | 1.40 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8°C |