Home
Products
alpha-Bisabolol
| Product Name | alpha-Bisabolol |
| Price: | Inquiry |
| Catalog No.: | CN09013 |
| CAS No.: | 23089-26-1 |
| Molecular Formula: | C15H26O |
| Molecular Weight: | 222.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Matricaria chamomilla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC[C@@]([C@H]1CCC(=CC1)C)(O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Levomenol is a monocyclic sesquiterpene alcohol found in various plants and mainly in Matricaria chamomilla, which exerts antioxidant, anti-inflammatory, and anti-apoptotic activities. Levomenol has neuroprotective effects, can attenuate nociceptive behaviour and central sensitisation in a rodent model of trigeminal neuropathic pain[1][2]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 314.5±11.0 °C at 760 mmHg |
| Flash Point | 113.2±15.6 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | ?20°C |