Home
Products
Eurycomalactone
| Product Name | Eurycomalactone |
| Price: | $409 / 10mg |
| Catalog No.: | CN08648 |
| CAS No.: | 23062-24-0 |
| Molecular Formula: | C19H24O6 |
| Molecular Weight: | 348.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Eurycoma longifolia Jack |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=C(C)[C@H]2[C@@]([C@@H]1O)(C)[C@H]1[C@@H](O)[C@H]3OC(=O)[C@@H]([C@@]1(C(=O)C2)C)[C@H]3C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eurycomalactone is a natural product found in Eurycoma longifolia Jack., acts as a potent NF-κB inhibitor, with an IC50 of 0.5 μM. Eurycomalactone inhibits protein synthesis, depletes cyclin D1, but does not affect TNFα-induced degradation of IκBα or the phosphorylation of IKKα/β and IκBα[1]. |
| Target | IC50: 0.5 μM (NF-κB)[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 588.1±50.0 °C at 760 mmHg |
| Flash Point | 213.1±23.6 °C |
| Exact Mass | 348.157288 |
| PSA | 100.90000 |
| LogP | -0.43 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |