Home
Products
Neoglycyrol
| Product Name | Neoglycyrol |
| Price: | $161 / 5mg |
| Catalog No.: | CN06143 |
| CAS No.: | 23013-84-5 |
| Molecular Formula: | C21H18O6 |
| Molecular Weight: | 366.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis Fisch. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(CC=C(C)C)c(O)cc2c1c1oc3c(c1c(=O)o2)ccc(c3)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoglycyrol is isolated from the root of Glycyrrhiza uralensis Fisch[1]. Neoglycyrol is a potential myocardial protection active compound screened from traditional patent medicine Tongmai Yangxin pill (TMYXP)[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 493.1±45.0 °C at 760 mmHg |
| Flash Point | 252.0±28.7 °C |
| Exact Mass | 366.110352 |
| PSA | 93.04000 |
| LogP | 5.45 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8C |