Home
Products
Kaempferol-3-beta-O-glucuronide
| Product Name | Kaempferol-3-beta-O-glucuronide |
| Price: | $511 / 5mg |
| Catalog No.: | CN05179 |
| CAS No.: | 22688-78-4 |
| Molecular Formula: | C21H18O12 |
| Molecular Weight: | 462.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Euphorbia lathyris |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol 3-O-β-D-glucuronide (Kaempferol-3-glucuronide), one conjugated kaempferol metabolite, has anti-inflammatory effect. Kaempferol 3-O-β-D-glucuronide significantly inhibits various pro-inflammatory mediators like IL-1β, NO, PGE2, and LTB4. Kaempferol 3-O-β-D-glucuronide upregulates the secretion of anti-inflammatory cytokine IL-10[1][2]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 876.8±65.0 °C at 760 mmHg |
| Flash Point | 309.8±27.8 °C |
| Exact Mass | 462.079834 |
| PSA | 207.35000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | ?20°C |