Home
Products
Betulinic acid methyl ester
| Product Name | Betulinic acid methyl ester |
| Price: | Inquiry |
| Catalog No.: | CN07230 |
| CAS No.: | 2259-06-5 |
| Molecular Formula: | C31H50O3 |
| Molecular Weight: | 470.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ziziphus jujuba |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)[C@@]12CC[C@H]([C@@H]2[C@@H]2[C@](CC1)(C)[C@]1(C)CC[C@@H]3[C@]([C@H]1CC2)(C)CC[C@@H](C3(C)C)O)C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Betulinic acid methyl ester, a betulinic acid derivative, possesses antiprotozoal activity[1]. |
| Density | 1.036g/cm3 |
| Boiling Point | 523.5ºC at 760mmHg |
| Flash Point | 189.5ºC |
| Exact Mass | 470.37600 |
| PSA | 46.53000 |
| LogP | 7.17790 |
| Vapour Pressure | 3.8E-13mmHg at 25°C |
| Storage condition | 2-8°C |