Home
Products
(+)-Carvone
| Product Name | (+)-Carvone |
| Price: | $23 / 50mg |
| Catalog No.: | CN09600 |
| CAS No.: | 2244-16-8 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The seed oil of dill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C)[C@H]1CC=C(C(=O)C1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (S)-(+)-Carvone (D Carvone) is a naturally occuring conmpound found in several food items and can be used in flavouring foods[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 230.5±35.0 °C at 760 mmHg |
| Flash Point | 88.9±0.0 °C |
| Exact Mass | 150.104462 |
| PSA | 17.07000 |
| LogP | 2.27 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |