Home
Products
Incensole
| Product Name | Incensole |
| Price: | $351 / 10mg |
| Catalog No.: | CN08495 |
| CAS No.: | 22419-74-5 |
| Molecular Formula: | C20H34O2 |
| Molecular Weight: | 306.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The resin of Boswellia carterii Birdw. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C/1=CC[C@@]2(CC[C@](O2)(C)[C@H](CC/C(=CCC1)/C)O)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression[1]. |
| Exact Mass | 306.25600 |
| PSA | 29.46000 |
| LogP | 5.16790 |