Home
Products
7-Methoxyflavone
| Product Name | 7-Methoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04392 |
| CAS No.: | 22395-22-8 |
| Molecular Formula: | C16H12O3 |
| Molecular Weight: | 252.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Zornia brasiliensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Methoxyflavone is a compound isolated from Zornia brasiliensis. 7-Methoxyflavone has peripheral antinociceptive activity. 7-Methoxyflavone inhibits paw-licking time in the neurogenic phase of the formalin pain response (65.6%) and did not decrease the nociceptive response in the inflammatory phase[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 421.2±45.0 °C at 760 mmHg |
| Flash Point | 200.3±15.1 °C |
| Exact Mass | 252.078644 |
| PSA | 39.44000 |
| LogP | 3.47 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Storage condition | 2-8°C |