Home
Products
3,8-Di-O-methylellagic acid
| Product Name | 3,8-Di-O-methylellagic acid |
| Price: | Inquiry |
| Catalog No.: | CN04073 |
| CAS No.: | 2239-88-5 |
| Molecular Formula: | C16H10O8 |
| Molecular Weight: | 330.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c3c1oc(=O)c1c3c(oc2=O)c(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,3'-Di-O-methylellagic acid obtained from Euphorbia adenochlora selectively inhibits the formation of acid-fastness in mycobacteria without retardation of their growth. 3,3'-di-O-methylellagic acid as a hepatoprotective compound is apparently due to its antioxidative effect[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 675.2±55.0 °C at 760 mmHg |
| Flash Point | 258.3±25.0 °C |
| Exact Mass | 330.037567 |
| PSA | 119.34000 |
| LogP | 1.58 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Storage condition | 2-8C |