Home
Products
Methyl ferulate
| Product Name | Methyl ferulate |
| Price: | $46 / 20mg |
| Catalog No.: | CN06864 |
| CAS No.: | 22329-76-6 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Oil |
| Source: | The roots of Stemona tuberosa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)/C=C/c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (E)-Ferulic acid methyl ester (Methyl (E)-ferulate) exhibits strong DPPH and ABTS+ radical scavenging activities[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 338.1±27.0 °C at 760 mmHg |
| Flash Point | 130.4±17.2 °C |
| Exact Mass | 208.073563 |
| PSA | 55.76000 |
| LogP | 1.40 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8℃ |