Home
Products
Platycodigenin
| Product Name | Platycodigenin |
| Price: | Inquiry |
| Catalog No.: | CN07701 |
| CAS No.: | 22327-82-8 |
| Molecular Formula: | C30H48O7 |
| Molecular Weight: | 520.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Platycodon grandiflorus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1(CO)[C@@H](O)[C@@H](O)C[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@@H](O)[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Platicodigenin isolated from platycodon grandiflorum. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 675.5±55.0 °C at 760 mmHg |
| Flash Point | 376.3±28.0 °C |
| Exact Mass | 520.340027 |
| PSA | 138.45000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |