Home
Products
Dihydroseselin
| Product Name | Dihydroseselin |
| Price: | $204 / 10mg |
| Catalog No.: | CN06068 |
| CAS No.: | 2221-66-1 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Toddalia asiatica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1(C)CCc2c(O1)ccc1c2oc(=O)cc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydroseselin is a 7-hydroxycoumarin (HY-N0573) derivative. 7-hydroxycoumarin is a natural product of the coumarin family, is a fluorescing compound which can be used as a sunscreen agent[1] |
| Density | 1.190±0.06 g/cm3(Predicted) |
| Boiling Point | 387.3±42.0 °C(Predicted) |
| Exact Mass | 230.09400 |
| PSA | 39.44000 |
| LogP | 2.89660 |