Home
Products
(+)-Neomenthol
| Product Name | (+)-Neomenthol |
| Price: | Inquiry |
| Catalog No.: | CN09601 |
| CAS No.: | 2216-52-6 |
| Molecular Formula: | C10H20O |
| Molecular Weight: | 156.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The essential oil of Mentha gentilis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@H]([C@H](C1)O)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Neomenthol is a potent miticide. (+)-Neomenthol shows acaricidal activitie with LD50 values of 0.32, 0.256 µg/mL for Dermatophagoides farinae and Dermatophagoides pteronyssinus, respectively[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 215.4±8.0 °C at 760 mmHg |
| Flash Point | 93.3±0.0 °C |
| Exact Mass | 156.151413 |
| PSA | 20.23000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | 2-8°C |