Home
Products
Kaempferol 3-gentiobioside
| Product Name | Kaempferol 3-gentiobioside |
| Price: | $117 / 10mg |
| Catalog No.: | CN05046 |
| CAS No.: | 22149-35-5 |
| Molecular Formula: | C27H30O16 |
| Molecular Weight: | 610.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Cinnamomum cassia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(Oc3c(oc4c(c3=O)c(O)cc(c4)O)c3ccc(cc3)O)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol 3-O-gentiobioside is a flavonoid isolated from C. alata leaves with antidiabetic activity. Kaempferol 3-O-gentiobioside possesses activity against α-glucosidase and displays carbohydrate enzyme inhibitory effect with an IC50 of 50.0 µM[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 991.0±65.0 °C at 760 mmHg |
| Flash Point | 328.0±27.8 °C |
| Exact Mass | 610.153381 |
| PSA | 269.43000 |
| LogP | -0.52 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |