Home
Products
Cytochalasin D
| Product Name | Cytochalasin D |
| Price: | Inquiry |
| Catalog No.: | CN02109 |
| CAS No.: | 22144-77-0 |
| Molecular Formula: | C30H37NO6 |
| Molecular Weight: | 507.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Engleromyces goetzii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1/C=C/[C@@](C)(O)C(=O)[C@H](C/C=C/[C@@H]2[C@]31C(=O)N[C@H]([C@@H]3[C@H](C)C(=C)[C@H]2O)Cc1ccccc1)C C30H37NO6 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cytochalasin D (Zygosporin A; NSC 209835) is a potent and cell-permeable inhibitor of actin polymerization derived from fungus, inhibits the G-actin–cofilin interaction by binding to G-actin. Cytochalasin D (Zygosporin A; NSC 209835) also inhibits the binding of cofilin to F-actin and decreases the rate of both actin polymerization and depolymerization in living cells[1][2][3]. |
| Target | G-actin[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 712.1±60.0 °C at 760 mmHg |
| Flash Point | 384.5±32.9 °C |
| Exact Mass | 507.262085 |
| PSA | 112.93000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | −20°C |