Home
Products
Cytochalasin C
| Product Name | Cytochalasin C |
| Price: | Inquiry |
| Catalog No.: | CN00606 |
| CAS No.: | 22144-76-9 |
| Molecular Formula: | C30H37NO6 |
| Molecular Weight: | 507.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The seed culture of solid wheat. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1/C=C/[C@@](C)(O)C(=O)[C@H](C/C=C/[C@@H]2[C@]31C(=O)N[C@H]([C@@H]3C(=C([C@H]2O)C)C)Cc1ccccc1)C C30H37NO6 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cytochalasin C is a cell-permeable fungal toxin and induces the formation of nuclear rodlets. Cytochalasin C is 10 times less toxic in mice than is cytochalasin D[1][2][3]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 714.3±60.0 °C at 760 mmHg |
| Flash Point | 385.8±32.9 °C |
| Exact Mass | 507.262085 |
| PSA | 112.93000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | −20°C |