Home
Products
NG,NG-Dimethylarginine dihydrochloride
| Product Name | NG,NG-Dimethylarginine dihydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN01977 |
| CAS No.: | 220805-22-1 |
| Molecular Formula: | C8H20Cl2N4O2 |
| Molecular Weight: | 275.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)[C@H](CCCNC(=N)N(C)C)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Asymmetric dimethylarginine dihydrochloride is an endogenous NO synthase inhibitor that reduces NO production, which contributes to endothelial dysfunction and cardiovascular disease[1]. |
| Boiling Point | 427.5ºC at 760 mmHg |
| Flash Point | 212.4ºC |
| Exact Mass | 274.096344 |
| PSA | 102.44000 |
| LogP | 2.05940 |
| Vapour Pressure | 1.66E-08mmHg at 25°C |