Home
Products
1-Methyl-2-pentyl-4(1H)-quinolinone
| Product Name | 1-Methyl-2-pentyl-4(1H)-quinolinone |
| Price: | $366 / 5mg |
| Catalog No.: | CN02110 |
| CAS No.: | 22048-98-2 |
| Molecular Formula: | C15H19NO |
| Molecular Weight: | 229.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Evodia rutaecarpa. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCc1cc(=O)c2c(n1C)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1-Methyl-2-pentyl-4(1H)-quinolinone, a quinolone alkaloid isolated from the fruits of Evodia Rutaecarpa, possesses antibacterial and cytotoxic activities for cancer cells[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 332.1±42.0 °C at 760 mmHg |
| Flash Point | 115.3±17.3 °C |
| Exact Mass | 229.146667 |
| PSA | 22.00000 |
| LogP | 3.97 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |