Home
Products
Isoescin IA
| Product Name | Isoescin IA |
| Price: | $249 / 10mg |
| Catalog No.: | CN07519 |
| CAS No.: | 219944-39-5 |
| Molecular Formula: | C55H86O24 |
| Molecular Weight: | 1131.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aesculus hippocastanum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@H]3CC(C)(C)[C@H]([C@@H]2O)OC(=O)/C(=C/C)/C)COC(=O)C)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoescin IA is a triterpenoid saponin isolated from the seeds of Aesculus chinensis. Isoescin IA has anti-HIV-1 protease activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1148.1±65.0 °C at 760 mmHg |
| Flash Point | 314.2±27.8 °C |
| Exact Mass | 1130.550903 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |