Home
Products
4',7-Dihydroxyflavone
| Product Name | 4',7-Dihydroxyflavone |
| Price: | $234 / 10mg |
| Catalog No.: | CN04975 |
| CAS No.: | 2196-14-7 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The heartwooda of Pterocarpus marsupium |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7,4'-Dihydroxyflavone (7,4'-DHF) is a flavonoid isolated from Glycyrrhiza uralensis, the eotaxin/CCL11 inhibitor, has the ability to consistently suppress eotaxin production and prevent dexamethasone (Dex)‐paradoxical adverse effects on eotaxin production[1]. 7,4'-Dihydroxyflavone (7,4'-DHF) inhibits MUC5AC gene expression, mucus production and secretion via regulation of NF-κB, STAT6 and HDAC2.7,4'-Dihydroxyflavone (7,4'-DHF) decreases phorbol 12-myristate 13-acetate (PMA) stimulated NCI-H292 human airway epithelial cell MUC5AC gene expression and mucus production with IC50 value of 1.4 µM[1]. |
| Target | IC50: 1.4 μM (NCI-H292 human airway epithelial cell) (7,4'-Dihydroxyflavone)[2] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 512.8±50.0 °C at 760 mmHg |
| Flash Point | 201.2±23.6 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |