Home
Products
Trans-Pinosylvin dimethyl ether
| Product Name | Trans-Pinosylvin dimethyl ether |
| Price: | Inquiry |
| Catalog No.: | CN03857 |
| CAS No.: | 21956-56-9 |
| Molecular Formula: | C16H16O2 |
| Molecular Weight: | 240.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Cryst. |
| Source: | The woods of Pinus palustris |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/c2ccccc2)cc(c1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | trans-3,5-Dimethoxystilbene (cis-Pinosylvin dimethyl ether) is a natural product that has been isolated from the benzene extract of the bark of jack pine (Pinus bunksiuna)[1]. |
| Density | 1.089g/cm3 |
| Boiling Point | 376.5ºC at 760mmHg |
| Flash Point | 150.7ºC |
| Exact Mass | 240.11500 |
| PSA | 18.46000 |
| LogP | 3.87420 |
| Vapour Pressure | 1.56E-05mmHg at 25°C |
| Storage condition | 2-8°C |