Home
Products
Falcarinol
| Product Name | Falcarinol |
| Price: | $439 / 10mg |
| Catalog No.: | CN06557 |
| CAS No.: | 21852-80-2 |
| Molecular Formula: | C17H24O |
| Molecular Weight: | 244.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The roots of Saposhnikovia divaricata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCC/C=CCC#CC#C[C@@H](C=C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Falcarinol (Panaxynol) is a natural, orally active Hsp90 inhibitor targeting both the N-terminal and C-terminal of Hsp90 with limited toxicities. Falcarinol (Panaxynol) induces apoptosis[1]. |
| In Vitro | Panaxynol inhibits the sphere-forming ability of NSCLC CSCs by inducing apoptosis. Panaxynol suppresses the viability of NSCLC cells with no effects on normal cells[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 370.6±42.0 °C at 760 mmHg |
| Flash Point | 163.4±20.9 °C |
| Exact Mass | 244.182709 |
| PSA | 20.23000 |
| LogP | 6.96 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |