Home
Products
Vindoline
| Product Name | Vindoline |
| Price: | $28 / 20mg |
| Catalog No.: | CN02113 |
| CAS No.: | 2182-14-1 |
| Molecular Formula: | C25H32N2O6 |
| Molecular Weight: | 456.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Catharanthus roseus (L.) G. Don |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)N(C)[C@@H]1[C@@]32CCN2[C@H]3[C@]([C@H]([C@]1(O)C(=O)OC)C(=O)C)(CC)C=CC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vindoline, a vinca alkaloid extracted from the leaves of Catharanthus roseus, weakly inhibits tubulin self-assembly[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 569.8±50.0 °C at 760 mmHg |
| Flash Point | 298.4±30.1 °C |
| Exact Mass | 456.226044 |
| PSA | 88.54000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | -20°C |