Home
Products
5-Demethylsinensetin
| Product Name | 5-Demethylsinensetin |
| Price: | $439 / 10mg |
| Catalog No.: | CN04230 |
| CAS No.: | 21763-80-4 |
| Molecular Formula: | C19H18O7 |
| Molecular Weight: | 358.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia princeps |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1=C(Oc2c([C]1(=O)OC)c(O)c(c(c2)OC)OC)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-desmethylsinensetin, isolated from Stevia satureiifolia var. satureiifolia, possesses antiprotozoal activity. 5-desmethylsinensetin shows IC50 values of 0.4 μg/mL on T. cruzi epimastigotes and 75.1 μg/mL on trypomastigotes, respectively[1]. |
| Density | 1.309g/cm3 |
| Boiling Point | 556.8ºC at 760mmHg |
| Flash Point | 200.7ºC |
| Exact Mass | 358.10500 |
| PSA | 87.36000 |
| LogP | 3.20000 |
| Vapour Pressure | 5.27E-13mmHg at 25°C |
| Storage condition | 2-8℃ |