Home
Products
5-O-Demethylnobiletin
| Product Name | 5-O-Demethylnobiletin |
| Price: | $103 / 20mg |
| Catalog No.: | CN04824 |
| CAS No.: | 2174-59-6 |
| Molecular Formula: | C20H20O8 |
| Molecular Weight: | 388.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus nobilis Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)c1cc(=O)c2c(o1)c(OC)c(c(c2O)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-O-Demethylnobiletin (5-Demethylnobiletin), a polymethoxyflavone isolated from Sideritis tragoriganum, is a direct inhibition of 5-LOX (IC50=0.1 μM), without affecting the expression of COX-2. 5-O-Demethylnobiletin (5-Demethylnobiletin) has anti-inflammatory activity, inhibits leukotriene B (4)(LTB4) formation in rat neutrophils and elastase release in human neutrophils with an IC50 of 0.35 μM[1].5-O-Demethylnobiletin (5-demethylnobiletin) promotes neuritogenesis through the activation of MAPK/ERK-, PKC-, and PKA-dependent signaling pathways[2]. |
| Target | IC50: 0.1 μM (Lox 5); 0.35 μM (LTB4) (5-O-Demethylnobiletin)[1] |
| Density | 1.304±0.06 g/cm3 |
| Boiling Point | 601.4±55.0 °C at 760 mmHg |
| Flash Point | 213.9±25.0 °C |
| Exact Mass | 388.115814 |
| PSA | 96.59000 |
| LogP | 2.10 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2-8C |